C18H23BO5 — CID 170802061
7-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,3-dihydrochromen-4-one (PubChem CID 170802061) has the molecular formula C18H23BO5 and a molecular weight of 330.19 g/mol. Its IUPAC name is 7-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,3-dihydrochromen-4-one.
| Compound Name | 7-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 170802061 |
| Molecular Formula | C18H23BO5 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 7-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,3-dihydrochromen-4-one |
| SMILES | CC1(C)OB(C(=Cc2ccc3c(c2)OCCC3=O)CO)OC1(C)C |
| InChI | InChI=1S/C18H23BO5/c1-17(2)18(3,4)24-19(23-17)13(11-20)9-12-5-6-14-15(21)7-8-22-16(14)10-12/h5-6,9-10,20H,7-8,11H2,1-4H3 |
| InChIKey | IFXIXMQAXNXSNL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|