C21H25BN2O2 — CID 170807174
3-(9H-carbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170807174) has the molecular formula C21H25BN2O2 and a molecular weight of 348.25 g/mol. Its IUPAC name is 3-(9H-carbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(9H-carbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170807174 |
| Molecular Formula | C21H25BN2O2 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-(9H-carbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CC1(C)OB(C(=Cc2ccc3[nH]c4ccccc4c3c2)CN)OC1(C)C |
| InChI | InChI=1S/C21H25BN2O2/c1-20(2)21(3,4)26-22(25-20)15(13-23)11-14-9-10-19-17(12-14)16-7-5-6-8-18(16)24-19/h5-12,24H,13,23H2,1-4H3 |
| InChIKey | HHCBLYXCPGXGCU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|