C18H23BN2O4 — CID 170807041
3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid (PubChem CID 170807041) has the molecular formula C18H23BN2O4 and a molecular weight of 342.20 g/mol. Its IUPAC name is 3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 170807041 |
| Molecular Formula | C18H23BN2O4 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2c(C(=O)O)[nH]c3ccccc23)CN)OC1(C)C |
| InChI | InChI=1S/C18H23BN2O4/c1-17(2)18(3,4)25-19(24-17)11(10-20)9-13-12-7-5-6-8-14(12)21-15(13)16(22)23/h5-9,21H,10,20H2,1-4H3,(H,22,23) |
| InChIKey | GAYLIKKTABAASB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|