C17H27BN2O2 — CID 170806366
2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-N,N-dimethylaniline (PubChem CID 170806366) has the molecular formula C17H27BN2O2 and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-N,N-dimethylaniline.
| Compound Name | 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 170806366 |
| Molecular Formula | C17H27BN2O2 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1C=C(CN)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H27BN2O2/c1-16(2)17(3,4)22-18(21-16)14(12-19)11-13-9-7-8-10-15(13)20(5)6/h7-11H,12,19H2,1-6H3 |
| InChIKey | QKDKYCCDMJQOGJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|