C18H28BNO4 — CID 170806824
3-[2-(dimethoxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170806824) has the molecular formula C18H28BNO4 and a molecular weight of 333.24 g/mol. Its IUPAC name is 3-[2-(dimethoxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-[2-(dimethoxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170806824 |
| Molecular Formula | C18H28BNO4 |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-[2-(dimethoxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | COC(OC)c1ccccc1C=C(CN)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H28BNO4/c1-17(2)18(3,4)24-19(23-17)14(12-20)11-13-9-7-8-10-15(13)16(21-5)22-6/h7-11,16H,12,20H2,1-6H3 |
| InChIKey | DNKFIPLCIWCCBR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|