C20H25BN2O5 — CID 170808670
3-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid (PubChem CID 170808670) has the molecular formula C20H25BN2O5 and a molecular weight of 384.24 g/mol. Its IUPAC name is 3-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 170808670 |
| Molecular Formula | C20H25BN2O5 |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 3-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1H-indole-2-carboxylic acid |
| SMILES | CC(=O)NCC(=Cc1c(C(=O)O)[nH]c2ccccc12)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H25BN2O5/c1-12(24)22-11-13(21-27-19(2,3)20(4,5)28-21)10-15-14-8-6-7-9-16(14)23-17(15)18(25)26/h6-10,23H,11H2,1-5H3,(H,22,24)(H,25,26) |
| InChIKey | AHXLEGJKNFDOSE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|