C19H24BNO3S — CID 170808091
N-[3-(1-benzothiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808091) has the molecular formula C19H24BNO3S and a molecular weight of 357.28 g/mol. Its IUPAC name is N-[3-(1-benzothiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(1-benzothiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808091 |
| Molecular Formula | C19H24BNO3S |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[3-(1-benzothiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1csc2ccccc12)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H24BNO3S/c1-13(22)21-11-15(20-23-18(2,3)19(4,5)24-20)10-14-12-25-17-9-7-6-8-16(14)17/h6-10,12H,11H2,1-5H3,(H,21,22) |
| InChIKey | ICMZUZXXECLOAJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|