C18H23BN2O3S — CID 170807960
N-[3-(2-isothiocyanatophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170807960) has the molecular formula C18H23BN2O3S and a molecular weight of 358.27 g/mol. Its IUPAC name is N-[3-(2-isothiocyanatophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(2-isothiocyanatophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807960 |
| Molecular Formula | C18H23BN2O3S |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[3-(2-isothiocyanatophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ccccc1N=C=S)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H23BN2O3S/c1-13(22)20-11-15(19-23-17(2,3)18(4,5)24-19)10-14-8-6-7-9-16(14)21-12-25/h6-10H,11H2,1-5H3,(H,20,22) |
| InChIKey | CZXDUNWAQISWIQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|