C18H22BF4NO3 — CID 170808426
N-[3-[3-fluoro-2-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808426) has the molecular formula C18H22BF4NO3 and a molecular weight of 387.18 g/mol. Its IUPAC name is N-[3-[3-fluoro-2-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-[3-fluoro-2-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808426 |
| Molecular Formula | C18H22BF4NO3 |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[3-[3-fluoro-2-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cccc(F)c1C(F)(F)F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H22BF4NO3/c1-11(25)24-10-13(19-26-16(2,3)17(4,5)27-19)9-12-7-6-8-14(20)15(12)18(21,22)23/h6-9H,10H2,1-5H3,(H,24,25) |
| InChIKey | PLRBMWCLGKRHGT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|