C20H28BNO7 — CID 170808762
4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,5-dimethoxybenzoic acid (PubChem CID 170808762) has the molecular formula C20H28BNO7 and a molecular weight of 405.26 g/mol. Its IUPAC name is 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,5-dimethoxybenzoic acid.
| Compound Name | 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 170808762 |
| Molecular Formula | C20H28BNO7 |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,5-dimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(OC)c1C=C(CNC(C)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H28BNO7/c1-12(23)22-11-14(21-28-19(2,3)20(4,5)29-21)10-15-16(26-6)8-13(18(24)25)9-17(15)27-7/h8-10H,11H2,1-7H3,(H,22,23)(H,24,25) |
| InChIKey | TYKRZCBIWFHONP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|