C15H21BN4O2 — CID 170806497
3-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170806497) has the molecular formula C15H21BN4O2 and a molecular weight of 300.17 g/mol. Its IUPAC name is 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170806497 |
| Molecular Formula | C15H21BN4O2 |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CC1(C)OB(C(=Cc2[nH]nc3ncccc23)CN)OC1(C)C |
| InChI | InChI=1S/C15H21BN4O2/c1-14(2)15(3,4)22-16(21-14)10(9-17)8-12-11-6-5-7-18-13(11)20-19-12/h5-8H,9,17H2,1-4H3,(H,18,19,20) |
| InChIKey | WBOJIPLUYCFXJB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|