About 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine
3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine (PubChem CID 169463700) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine |
| PubChem CID | 169463700 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine |
| SMILES | NCC=Cc1[nH]nc2ncccc12 |
| InChI | InChI=1S/C9H10N4/c10-5-1-4-8-7-3-2-6-11-9(7)13-12-8/h1-4,6H,5,10H2,(H,11,12,13) |
| InChIKey | QQVBGBINPOWKKG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine?
The IUPAC name of 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine (CID 169463700) is 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine.
What is the SMILES notation for 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine?
The canonical SMILES for 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine is NCC=Cc1[nH]nc2ncccc12.
What is the InChIKey of 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine?
The InChIKey is QQVBGBINPOWKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c10-5-1-4-8-7-3-2-6-11-9(7)13-12-8/h1-4,6H,5,10H2,(H,11,12,13).
What are the key properties of 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine?
3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine has a molecular weight of 174.21 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-en-1-amine is sourced from PubChem (CID 169463700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).