C6H7ClN4 — CID 155662054
2H-pyrazolo[3,4-b]pyridin-3-amine;hydrochloride (PubChem CID 155662054) has the molecular formula C6H7ClN4 and a molecular weight of 170.60 g/mol. Its IUPAC name is 2H-pyrazolo[3,4-b]pyridin-3-amine;hydrochloride.
| Compound Name | 2H-pyrazolo[3,4-b]pyridin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 155662054 |
| Molecular Formula | C6H7ClN4 |
| Molecular Weight | 170.60 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 2H-pyrazolo[3,4-b]pyridin-3-amine;hydrochloride |
| SMILES | Cl.Nc1[nH]nc2ncccc12 |
| InChI | InChI=1S/C6H6N4.ClH/c7-5-4-2-1-3-8-6(4)10-9-5;/h1-3H,(H3,7,8,9,10);1H |
| InChIKey | GGAUSSUHMWHVFO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.60 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |