C16H12N4 — CID 141330351
4-naphthalen-1-yl-2H-pyrazolo[3,4-b]pyridin-3-amine (PubChem CID 141330351) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-naphthalen-1-yl-2H-pyrazolo[3,4-b]pyridin-3-amine.
| Compound Name | 4-naphthalen-1-yl-2H-pyrazolo[3,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 141330351 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 4-naphthalen-1-yl-2H-pyrazolo[3,4-b]pyridin-3-amine |
| SMILES | Nc1[nH]nc2nccc(-c3cccc4ccccc34)c12 |
| InChI | InChI=1S/C16H12N4/c17-15-14-13(8-9-18-16(14)20-19-15)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H,(H3,17,18,19,20) |
| InChIKey | NDHFGRSYCFZQMX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |