C15H13N3 — CID 174822585
4-naphthalen-1-ylpyridine-2,3-diamine (PubChem CID 174822585) has the molecular formula C15H13N3 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-naphthalen-1-ylpyridine-2,3-diamine.
| Compound Name | 4-naphthalen-1-ylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 174822585 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 4-naphthalen-1-ylpyridine-2,3-diamine |
| SMILES | Nc1nccc(-c2cccc3ccccc23)c1N |
| InChI | InChI=1S/C15H13N3/c16-14-13(8-9-18-15(14)17)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H,16H2,(H2,17,18) |
| InChIKey | BYPQHZCKZDYNAV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |