About ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane
ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane (PubChem CID 143179270) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane.
Molecular Properties
| Compound Name | ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane |
| PubChem CID | 143179270 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane |
| SMILES | CC.CCC.Cc1[nH]nc2ncccc12 |
| InChI | InChI=1S/C7H7N3.C3H8.C2H6/c1-5-6-3-2-4-8-7(6)10-9-5;1-3-2;1-2/h2-4H,1H3,(H,8,9,10);3H2,1-2H3;1-2H3 |
| InChIKey | BEDAGAQSXYQKIJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane?
The IUPAC name of ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane (CID 143179270) is ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane.
What is the SMILES notation for ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane?
The canonical SMILES for ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane is CC.CCC.Cc1[nH]nc2ncccc12.
What is the InChIKey of ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane?
The InChIKey is BEDAGAQSXYQKIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.C3H8.C2H6/c1-5-6-3-2-4-8-7(6)10-9-5;1-3-2;1-2/h2-4H,1H3,(H,8,9,10);3H2,1-2H3;1-2H3.
What are the key properties of ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane?
ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane has a molecular weight of 207.32 g/mol, XLogP of 3.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-2H-pyrazolo[3,4-b]pyridine;propane is sourced from PubChem (CID 143179270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).