C12H19N3 — CID 161040738
3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane (PubChem CID 161040738) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane.
| Compound Name | 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane |
|---|---|
| PubChem CID | 161040738 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane |
| SMILES | CC.CC(C)(C)c1[nH]nc2ncccc12 |
| InChI | InChI=1S/C10H13N3.C2H6/c1-10(2,3)8-7-5-4-6-11-9(7)13-12-8;1-2/h4-6H,1-3H3,(H,11,12,13);1-2H3 |
| InChIKey | UAVRHCJAKMSZJT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |