About 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane
3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane (PubChem CID 161040738) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane.
Molecular Properties
| Compound Name | 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane |
| PubChem CID | 161040738 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane |
| SMILES | CC.CC(C)(C)c1[nH]nc2ncccc12 |
| InChI | InChI=1S/C10H13N3.C2H6/c1-10(2,3)8-7-5-4-6-11-9(7)13-12-8;1-2/h4-6H,1-3H3,(H,11,12,13);1-2H3 |
| InChIKey | UAVRHCJAKMSZJT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane?
The IUPAC name of 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane (CID 161040738) is 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane.
What is the SMILES notation for 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane?
The canonical SMILES for 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane is CC.CC(C)(C)c1[nH]nc2ncccc12.
What is the InChIKey of 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane?
The InChIKey is UAVRHCJAKMSZJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3.C2H6/c1-10(2,3)8-7-5-4-6-11-9(7)13-12-8;1-2/h4-6H,1-3H3,(H,11,12,13);1-2H3.
What are the key properties of 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane?
3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane has a molecular weight of 205.30 g/mol, XLogP of 3.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2H-pyrazolo[3,4-b]pyridine;ethane is sourced from PubChem (CID 161040738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).