C16H14N4O — CID 69137142
N-benzyl-3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-enamide (PubChem CID 69137142) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is N-benzyl-3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-enamide.
| Compound Name | N-benzyl-3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 69137142 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-benzyl-3-(2H-pyrazolo[3,4-b]pyridin-3-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1[nH]nc2ncccc12)NCc1ccccc1 |
| InChI | InChI=1S/C16H14N4O/c21-15(18-11-12-5-2-1-3-6-12)9-8-14-13-7-4-10-17-16(13)20-19-14/h1-10H,11H2,(H,18,21)(H,17,19,20) |
| InChIKey | YBWRSSXUBAVKPU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|