C19H21BO6S — CID 170803928
4-oxo-6-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]chromene-2-carboxylic acid (PubChem CID 170803928) has the molecular formula C19H21BO6S and a molecular weight of 388.25 g/mol. Its IUPAC name is 4-oxo-6-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]chromene-2-carboxylic acid.
| Compound Name | 4-oxo-6-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 170803928 |
| Molecular Formula | C19H21BO6S |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-oxo-6-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]chromene-2-carboxylic acid |
| SMILES | CC1(C)OB(C(=Cc2ccc3oc(C(=O)O)cc(=O)c3c2)CS)OC1(C)C |
| InChI | InChI=1S/C19H21BO6S/c1-18(2)19(3,4)26-20(25-18)12(10-27)7-11-5-6-15-13(8-11)14(21)9-16(24-15)17(22)23/h5-9,27H,10H2,1-4H3,(H,22,23) |
| InChIKey | YVKTUMWOKUPGMO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|