C18H26BNO4S — CID 170803860
ethyl 2-amino-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate (PubChem CID 170803860) has the molecular formula C18H26BNO4S and a molecular weight of 363.29 g/mol. Its IUPAC name is ethyl 2-amino-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate.
| Compound Name | ethyl 2-amino-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 170803860 |
| Molecular Formula | C18H26BNO4S |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | ethyl 2-amino-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate |
| SMILES | CCOC(=O)c1cc(C=C(CS)B2OC(C)(C)C(C)(C)O2)ccc1N |
| InChI | InChI=1S/C18H26BNO4S/c1-6-22-16(21)14-10-12(7-8-15(14)20)9-13(11-25)19-23-17(2,3)18(4,5)24-19/h7-10,25H,6,11,20H2,1-5H3 |
| InChIKey | HPSFXVYCTHSVHE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|