C16H24BNO4S2 — CID 170803651
ethyl 4-methyl-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-5-carboxylate (PubChem CID 170803651) has the molecular formula C16H24BNO4S2 and a molecular weight of 369.32 g/mol. Its IUPAC name is ethyl 4-methyl-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 170803651 |
| Molecular Formula | C16H24BNO4S2 |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | ethyl 4-methyl-2-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(C=C(CS)B2OC(C)(C)C(C)(C)O2)nc1C |
| InChI | InChI=1S/C16H24BNO4S2/c1-7-20-14(19)13-10(2)18-12(24-13)8-11(9-23)17-21-15(3,4)16(5,6)22-17/h8,23H,7,9H2,1-6H3 |
| InChIKey | RLNONCQTDAJZNO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|