C13H20BNO4S3 — CID 170803160
5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-sulfonamide (PubChem CID 170803160) has the molecular formula C13H20BNO4S3 and a molecular weight of 361.32 g/mol. Its IUPAC name is 5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-sulfonamide.
| Compound Name | 5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 170803160 |
| Molecular Formula | C13H20BNO4S3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-sulfonamide |
| SMILES | CC1(C)OB(C(=Cc2ccc(S(N)(=O)=O)s2)CS)OC1(C)C |
| InChI | InChI=1S/C13H20BNO4S3/c1-12(2)13(3,4)19-14(18-12)9(8-20)7-10-5-6-11(21-10)22(15,16)17/h5-7,20H,8H2,1-4H3,(H2,15,16,17) |
| InChIKey | KOYFQJLXRXEIGN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|