C14H18BCl2NO2S — CID 170802814
3-(3,5-dichloro-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170802814) has the molecular formula C14H18BCl2NO2S and a molecular weight of 346.09 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(3,5-dichloro-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170802814 |
| Molecular Formula | C14H18BCl2NO2S |
| Molecular Weight | 346.09 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 3-(3,5-dichloro-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2c(Cl)cncc2Cl)CS)OC1(C)C |
| InChI | InChI=1S/C14H18BCl2NO2S/c1-13(2)14(3,4)20-15(19-13)9(8-21)5-10-11(16)6-18-7-12(10)17/h5-7,21H,8H2,1-4H3 |
| InChIKey | GFSXJRHHNSRDOV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 31.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.09 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|