C15H18BCl3O2S — CID 170802890
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(3,4,5-trichlorophenyl)prop-2-ene-1-thiol (PubChem CID 170802890) has the molecular formula C15H18BCl3O2S and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(3,4,5-trichlorophenyl)prop-2-ene-1-thiol.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(3,4,5-trichlorophenyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170802890 |
| Molecular Formula | C15H18BCl3O2S |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(3,4,5-trichlorophenyl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2cc(Cl)c(Cl)c(Cl)c2)CS)OC1(C)C |
| InChI | InChI=1S/C15H18BCl3O2S/c1-14(2)15(3,4)21-16(20-14)10(8-22)5-9-6-11(17)13(19)12(18)7-9/h5-7,22H,8H2,1-4H3 |
| InChIKey | GXBIKUITZOXBEJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|