C15H22BNO3S — CID 170813909
5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-carbaldehyde (PubChem CID 170813909) has the molecular formula C15H22BNO3S and a molecular weight of 307.22 g/mol. Its IUPAC name is 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 170813909 |
| Molecular Formula | C15H22BNO3S |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophene-2-carbaldehyde |
| SMILES | CNCC(=Cc1ccc(C=O)s1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H22BNO3S/c1-14(2)15(3,4)20-16(19-14)11(9-17-5)8-12-6-7-13(10-18)21-12/h6-8,10,17H,9H2,1-5H3 |
| InChIKey | RTBJFEDYMBBCFD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|