C18H26BNO5S — CID 170815237
4-[5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]-4-oxobutanoic acid (PubChem CID 170815237) has the molecular formula C18H26BNO5S and a molecular weight of 379.29 g/mol. Its IUPAC name is 4-[5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 170815237 |
| Molecular Formula | C18H26BNO5S |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[5-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]thiophen-2-yl]-4-oxobutanoic acid |
| SMILES | CNCC(=Cc1ccc(C(=O)CCC(=O)O)s1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H26BNO5S/c1-17(2)18(3,4)25-19(24-17)12(11-20-5)10-13-6-8-15(26-13)14(21)7-9-16(22)23/h6,8,10,20H,7,9,11H2,1-5H3,(H,22,23) |
| InChIKey | XLHGNMIVKCBIJO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|