C14H20BN2O4S- — CID 170814233
4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-2-carboxylate (PubChem CID 170814233) has the molecular formula C14H20BN2O4S- and a molecular weight of 323.20 g/mol. Its IUPAC name is 4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-2-carboxylate.
| Compound Name | 4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 170814233 |
| Molecular Formula | C14H20BN2O4S- |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-2-carboxylate |
| SMILES | CNCC(=Cc1csc(C(=O)[O-])n1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H21BN2O4S/c1-13(2)14(3,4)21-15(20-13)9(7-16-5)6-10-8-22-11(17-10)12(18)19/h6,8,16H,7H2,1-5H3,(H,18,19)/p-1 |
| InChIKey | ZRNNWZPEHRZVEM-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|