C14H21BN2O3S — CID 170807346
N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-4-yl)prop-2-enyl]acetamide (PubChem CID 170807346) has the molecular formula C14H21BN2O3S and a molecular weight of 308.21 g/mol. Its IUPAC name is N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-4-yl)prop-2-enyl]acetamide.
| Compound Name | N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-4-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807346 |
| Molecular Formula | C14H21BN2O3S |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-4-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cscn1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H21BN2O3S/c1-10(18)16-7-11(6-12-8-21-9-17-12)15-19-13(2,3)14(4,5)20-15/h6,8-9H,7H2,1-5H3,(H,16,18) |
| InChIKey | DQPXIAAZCQSCQL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|