C15H21BClN3O3 — CID 170808857
N-[3-(5-chloropyrimidin-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808857) has the molecular formula C15H21BClN3O3 and a molecular weight of 337.62 g/mol. Its IUPAC name is N-[3-(5-chloropyrimidin-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(5-chloropyrimidin-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808857 |
| Molecular Formula | C15H21BClN3O3 |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[3-(5-chloropyrimidin-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ncc(Cl)cn1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H21BClN3O3/c1-10(21)18-7-11(6-13-19-8-12(17)9-20-13)16-22-14(2,3)15(4,5)23-16/h6,8-9H,7H2,1-5H3,(H,18,21) |
| InChIKey | IYIDCPDJXUQDMY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|