C12H19BN2O2S — CID 170805717
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-4-yl)prop-2-en-1-amine (PubChem CID 170805717) has the molecular formula C12H19BN2O2S and a molecular weight of 266.18 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-4-yl)prop-2-en-1-amine.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-4-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170805717 |
| Molecular Formula | C12H19BN2O2S |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(1,3-thiazol-4-yl)prop-2-en-1-amine |
| SMILES | CC1(C)OB(C(=Cc2cscn2)CN)OC1(C)C |
| InChI | InChI=1S/C12H19BN2O2S/c1-11(2)12(3,4)17-13(16-11)9(6-14)5-10-7-18-8-15-10/h5,7-8H,6,14H2,1-4H3 |
| InChIKey | CKJFYXSTIJNKGL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|