C14H22BN3O2 — CID 170805785
3-(6-methylpyrazin-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170805785) has the molecular formula C14H22BN3O2 and a molecular weight of 275.16 g/mol. Its IUPAC name is 3-(6-methylpyrazin-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(6-methylpyrazin-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170805785 |
| Molecular Formula | C14H22BN3O2 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 3-(6-methylpyrazin-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | Cc1cncc(C=C(CN)B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C14H22BN3O2/c1-10-8-17-9-12(18-10)6-11(7-16)15-19-13(2,3)14(4,5)20-15/h6,8-9H,7,16H2,1-5H3 |
| InChIKey | ZWGXMDRXHCSCPO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|