C13H20BClN4O2 — CID 170806124
5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-chloropyrimidin-4-amine (PubChem CID 170806124) has the molecular formula C13H20BClN4O2 and a molecular weight of 310.59 g/mol. Its IUPAC name is 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-chloropyrimidin-4-amine.
| Compound Name | 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 170806124 |
| Molecular Formula | C13H20BClN4O2 |
| Molecular Weight | 310.59 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-chloropyrimidin-4-amine |
| SMILES | CC1(C)OB(C(=Cc2cnc(Cl)nc2N)CN)OC1(C)C |
| InChI | InChI=1S/C13H20BClN4O2/c1-12(2)13(3,4)21-14(20-12)9(6-16)5-8-7-18-11(15)19-10(8)17/h5,7H,6,16H2,1-4H3,(H2,17,18,19) |
| InChIKey | KCWHPFMUTLYNLV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.59 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|