C15H22BN5O2 — CID 170807303
5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 170807303) has the molecular formula C15H22BN5O2 and a molecular weight of 315.19 g/mol. Its IUPAC name is 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170807303 |
| Molecular Formula | C15H22BN5O2 |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1(C)OB(C(=Cc2c[nH]c3ncnc(N)c23)CN)OC1(C)C |
| InChI | InChI=1S/C15H22BN5O2/c1-14(2)15(3,4)23-16(22-14)10(6-17)5-9-7-19-13-11(9)12(18)20-8-21-13/h5,7-8H,6,17H2,1-4H3,(H3,18,19,20,21) |
| InChIKey | VKTOTPMEQQNYNL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|