C20H30BN5O4 — CID 170810561
tert-butyl N-[3-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810561) has the molecular formula C20H30BN5O4 and a molecular weight of 415.30 g/mol. Its IUPAC name is tert-butyl N-[3-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810561 |
| Molecular Formula | C20H30BN5O4 |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | tert-butyl N-[3-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1c[nH]c2ncnc(N)c12)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H30BN5O4/c1-18(2,3)28-17(27)24-10-13(21-29-19(4,5)20(6,7)30-21)8-12-9-23-16-14(12)15(22)25-11-26-16/h8-9,11H,10H2,1-7H3,(H,24,27)(H3,22,23,25,26) |
| InChIKey | MIWUACYMIKSBJU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|