C20H30BFN2O4 — CID 170810528
tert-butyl N-[3-(2-fluoro-3-methyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810528) has the molecular formula C20H30BFN2O4 and a molecular weight of 392.28 g/mol. Its IUPAC name is tert-butyl N-[3-(2-fluoro-3-methyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-fluoro-3-methyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810528 |
| Molecular Formula | C20H30BFN2O4 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | tert-butyl N-[3-(2-fluoro-3-methyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1c(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)ccnc1F |
| InChI | InChI=1S/C20H30BFN2O4/c1-13-14(9-10-23-16(13)22)11-15(12-24-17(25)26-18(2,3)4)21-27-19(5,6)20(7,8)28-21/h9-11H,12H2,1-8H3,(H,24,25) |
| InChIKey | QKMHSJWMCJFBLB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|