C21H28BF2NO6 — CID 170810101
2,6-difluoro-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid (PubChem CID 170810101) has the molecular formula C21H28BF2NO6 and a molecular weight of 439.26 g/mol. Its IUPAC name is 2,6-difluoro-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 2,6-difluoro-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170810101 |
| Molecular Formula | C21H28BF2NO6 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2,6-difluoro-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc(F)c(C(=O)O)c1F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H28BF2NO6/c1-19(2,3)29-18(28)25-11-13(22-30-20(4,5)21(6,7)31-22)10-12-8-9-14(23)15(16(12)24)17(26)27/h8-10H,11H2,1-7H3,(H,25,28)(H,26,27) |
| InChIKey | BNRFDQOGMIMHBK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|