C23H34BNO6 — CID 170810087
2,6-dimethyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid (PubChem CID 170810087) has the molecular formula C23H34BNO6 and a molecular weight of 431.34 g/mol. Its IUPAC name is 2,6-dimethyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 2,6-dimethyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170810087 |
| Molecular Formula | C23H34BNO6 |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 2,6-dimethyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
| SMILES | Cc1cc(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)cc(C)c1C(=O)O |
| InChI | InChI=1S/C23H34BNO6/c1-14-10-16(11-15(2)18(14)19(26)27)12-17(13-25-20(28)29-21(3,4)5)24-30-22(6,7)23(8,9)31-24/h10-12H,13H2,1-9H3,(H,25,28)(H,26,27) |
| InChIKey | HLZAFMBSFHUIFX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|