C19H28BN3O6 — CID 170809569
5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrimidine-2-carboxylic acid (PubChem CID 170809569) has the molecular formula C19H28BN3O6 and a molecular weight of 405.26 g/mol. Its IUPAC name is 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrimidine-2-carboxylic acid.
| Compound Name | 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 170809569 |
| Molecular Formula | C19H28BN3O6 |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrimidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cnc(C(=O)O)nc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H28BN3O6/c1-17(2,3)27-16(26)23-11-13(20-28-18(4,5)19(6,7)29-20)8-12-9-21-14(15(24)25)22-10-12/h8-10H,11H2,1-7H3,(H,23,26)(H,24,25) |
| InChIKey | MVNYLFFBDOPJPQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|