C19H29BFN3O4 — CID 170809223
tert-butyl N-[3-(6-amino-5-fluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809223) has the molecular formula C19H29BFN3O4 and a molecular weight of 393.27 g/mol. Its IUPAC name is tert-butyl N-[3-(6-amino-5-fluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(6-amino-5-fluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809223 |
| Molecular Formula | C19H29BFN3O4 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | tert-butyl N-[3-(6-amino-5-fluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cnc(N)c(F)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H29BFN3O4/c1-17(2,3)26-16(25)24-11-13(8-12-9-14(21)15(22)23-10-12)20-27-18(4,5)19(6,7)28-20/h8-10H,11H2,1-7H3,(H2,22,23)(H,24,25) |
| InChIKey | NCRATODTJYJFHA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|