C20H31BN4O6 — CID 170810194
methyl 3-amino-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazine-2-carboxylate (PubChem CID 170810194) has the molecular formula C20H31BN4O6 and a molecular weight of 434.30 g/mol. Its IUPAC name is methyl 3-amino-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazine-2-carboxylate.
| Compound Name | methyl 3-amino-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 170810194 |
| Molecular Formula | C20H31BN4O6 |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | methyl 3-amino-6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(C=C(CNC(=O)OC(C)(C)C)B2OC(C)(C)C(C)(C)O2)cnc1N |
| InChI | InChI=1S/C20H31BN4O6/c1-18(2,3)29-17(27)24-10-12(21-30-19(4,5)20(6,7)31-21)9-13-11-23-15(22)14(25-13)16(26)28-8/h9,11H,10H2,1-8H3,(H2,22,23)(H,24,27) |
| InChIKey | CCCYKPYNVRTXBQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|