C20H28BF3N2O4 — CID 170809960
tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]carbamate (PubChem CID 170809960) has the molecular formula C20H28BF3N2O4 and a molecular weight of 428.26 g/mol. Its IUPAC name is tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809960 |
| Molecular Formula | C20H28BF3N2O4 |
| Molecular Weight | 428.26 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccc(C(F)(F)F)cn1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H28BF3N2O4/c1-17(2,3)28-16(27)26-12-14(21-29-18(4,5)19(6,7)30-21)10-15-9-8-13(11-25-15)20(22,23)24/h8-11H,12H2,1-7H3,(H,26,27) |
| InChIKey | LVTKGQXFLZWBMK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|