C21H29BF3NO5 — CID 170810107
tert-butyl N-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810107) has the molecular formula C21H29BF3NO5 and a molecular weight of 443.27 g/mol. Its IUPAC name is tert-butyl N-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810107 |
| Molecular Formula | C21H29BF3NO5 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | tert-butyl N-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cc(C(F)(F)F)ccc1O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H29BF3NO5/c1-18(2,3)29-17(28)26-12-15(22-30-19(4,5)20(6,7)31-22)11-13-10-14(21(23,24)25)8-9-16(13)27/h8-11,27H,12H2,1-7H3,(H,26,28) |
| InChIKey | XMPUICRONUYCNX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|