C28H34BNO4 — CID 170810457
tert-butyl N-[3-phenanthren-9-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810457) has the molecular formula C28H34BNO4 and a molecular weight of 459.40 g/mol. Its IUPAC name is tert-butyl N-[3-phenanthren-9-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-phenanthren-9-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810457 |
| Molecular Formula | C28H34BNO4 |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | tert-butyl N-[3-phenanthren-9-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cc2ccccc2c2ccccc12)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C28H34BNO4/c1-26(2,3)32-25(31)30-18-21(29-33-27(4,5)28(6,7)34-29)17-20-16-19-12-8-9-13-22(19)24-15-11-10-14-23(20)24/h8-17H,18H2,1-7H3,(H,30,31) |
| InChIKey | RVMIVBZNEQVWLK-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|