C20H29BBrNO4 — CID 170810481
tert-butyl N-[3-(2-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810481) has the molecular formula C20H29BBrNO4 and a molecular weight of 438.17 g/mol. Its IUPAC name is tert-butyl N-[3-(2-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810481 |
| Molecular Formula | C20H29BBrNO4 |
| Molecular Weight | 438.17 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | tert-butyl N-[3-(2-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccccc1Br)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H29BBrNO4/c1-18(2,3)25-17(24)23-13-15(12-14-10-8-9-11-16(14)22)21-26-19(4,5)20(6,7)27-21/h8-12H,13H2,1-7H3,(H,23,24) |
| InChIKey | FHWVZNPFTLIIKN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.17 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|