C25H39BN2O4 — CID 170810294
tert-butyl N-[3-(2-piperidin-1-ylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810294) has the molecular formula C25H39BN2O4 and a molecular weight of 442.41 g/mol. Its IUPAC name is tert-butyl N-[3-(2-piperidin-1-ylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-piperidin-1-ylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810294 |
| Molecular Formula | C25H39BN2O4 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | tert-butyl N-[3-(2-piperidin-1-ylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1ccccc1N1CCCCC1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H39BN2O4/c1-23(2,3)30-22(29)27-18-20(26-31-24(4,5)25(6,7)32-26)17-19-13-9-10-14-21(19)28-15-11-8-12-16-28/h9-10,13-14,17H,8,11-12,15-16,18H2,1-7H3,(H,27,29) |
| InChIKey | PCBRZZZKMLLVLC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|