C21H31BClNO4 — CID 170809134
tert-butyl N-[3-(3-chloro-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809134) has the molecular formula C21H31BClNO4 and a molecular weight of 407.75 g/mol. Its IUPAC name is tert-butyl N-[3-(3-chloro-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-chloro-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809134 |
| Molecular Formula | C21H31BClNO4 |
| Molecular Weight | 407.75 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | tert-butyl N-[3-(3-chloro-2-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1c(Cl)cccc1C=C(CNC(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H31BClNO4/c1-14-15(10-9-11-17(14)23)12-16(13-24-18(25)26-19(2,3)4)22-27-20(5,6)21(7,8)28-22/h9-12H,13H2,1-8H3,(H,24,25) |
| InChIKey | HFTYZWCYZIVPSI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.75 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|