C20H30BClN2O4 — CID 170809277
tert-butyl N-[3-(5-amino-2-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809277) has the molecular formula C20H30BClN2O4 and a molecular weight of 408.74 g/mol. Its IUPAC name is tert-butyl N-[3-(5-amino-2-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-amino-2-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809277 |
| Molecular Formula | C20H30BClN2O4 |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | tert-butyl N-[3-(5-amino-2-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cc(N)ccc1Cl)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H30BClN2O4/c1-18(2,3)26-17(25)24-12-14(10-13-11-15(23)8-9-16(13)22)21-27-19(4,5)20(6,7)28-21/h8-11H,12,23H2,1-7H3,(H,24,25) |
| InChIKey | LHHFYYLODIHVOV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|