C21H29BClNO6 — CID 170809762
tert-butyl N-[3-(6-chloro-1,3-benzodioxol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809762) has the molecular formula C21H29BClNO6 and a molecular weight of 437.73 g/mol. Its IUPAC name is tert-butyl N-[3-(6-chloro-1,3-benzodioxol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(6-chloro-1,3-benzodioxol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809762 |
| Molecular Formula | C21H29BClNO6 |
| Molecular Weight | 437.73 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | tert-butyl N-[3-(6-chloro-1,3-benzodioxol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cc2c(cc1Cl)OCO2)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H29BClNO6/c1-19(2,3)28-18(25)24-11-14(22-29-20(4,5)21(6,7)30-22)8-13-9-16-17(10-15(13)23)27-12-26-16/h8-10H,11-12H2,1-7H3,(H,24,25) |
| InChIKey | BPFZWSZBETUISU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.73 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|