C21H32BN3O4 — CID 170809564
tert-butyl N-[3-(2-carbamimidoylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809564) has the molecular formula C21H32BN3O4 and a molecular weight of 401.32 g/mol. Its IUPAC name is tert-butyl N-[3-(2-carbamimidoylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-carbamimidoylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809564 |
| Molecular Formula | C21H32BN3O4 |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | tert-butyl N-[3-(2-carbamimidoylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | [H]/N=C(\N)c1ccccc1C=C(CNC(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H32BN3O4/c1-19(2,3)27-18(26)25-13-15(22-28-20(4,5)21(6,7)29-22)12-14-10-8-9-11-16(14)17(23)24/h8-12H,13H2,1-7H3,(H3,23,24)(H,25,26) |
| InChIKey | CFKZABRPGWVXHH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|