C21H31BN2O6 — CID 170809998
3-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid (PubChem CID 170809998) has the molecular formula C21H31BN2O6 and a molecular weight of 418.30 g/mol. Its IUPAC name is 3-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 3-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170809998 |
| Molecular Formula | C21H31BN2O6 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 3-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1c(N)cccc1C(=O)O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H31BN2O6/c1-19(2,3)28-18(27)24-12-13(22-29-20(4,5)21(6,7)30-22)11-15-14(17(25)26)9-8-10-16(15)23/h8-11H,12,23H2,1-7H3,(H,24,27)(H,25,26) |
| InChIKey | LBZRKYQQUIFIJJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|